C17H32N6O2 — CID 111885109
tert-butyl N-[2-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885109) has the molecular formula C17H32N6O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885109 |
| Molecular Formula | C17H32N6O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCCc1cnn(C)c1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N6O2/c1-6-18-15(19-9-7-8-14-12-22-23(5)13-14)20-10-11-21-16(24)25-17(2,3)4/h12-13H,6-11H2,1-5H3,(H,21,24)(H2,18,19,20) |
| InChIKey | GRWVJGCWRZIEDI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|