C16H31IN6O2 — CID 111887268
tert-butyl N-[3-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111887268) has the molecular formula C16H31IN6O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887268 |
| Molecular Formula | C16H31IN6O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCCn1cccn1.I |
| InChI | InChI=1S/C16H30N6O2.HI/c1-16(2,3)24-15(23)20-9-5-8-18-14(17-4)19-10-6-12-22-13-7-11-21-22;/h7,11,13H,5-6,8-10,12H2,1-4H3,(H,20,23)(H2,17,18,19);1H |
| InChIKey | VQHZDVGMHQACDF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|