C11H22IN5O2S — CID 111906128
2-methyl-1-(2-methylsulfonylethyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111906128) has the molecular formula C11H22IN5O2S and a molecular weight of 415.30 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfonylethyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfonylethyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111906128 |
| Molecular Formula | C11H22IN5O2S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-methyl-1-(2-methylsulfonylethyl)-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1cccn1)NCCS(C)(=O)=O.I |
| InChI | InChI=1S/C11H21N5O2S.HI/c1-12-11(14-7-10-19(2,17)18)13-5-3-8-16-9-4-6-15-16;/h4,6,9H,3,5,7-8,10H2,1-2H3,(H2,12,13,14);1H |
| InChIKey | PQHAMBPCVKSDMU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|