C14H24N6O — CID 111904643
N-[2-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111904643) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111904643 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[2-[[N'-methyl-N-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | C/N=C(/NCCCn1cccn1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C14H24N6O/c1-15-14(17-6-2-10-20-11-3-7-19-20)18-9-8-16-13(21)12-4-5-12/h3,7,11-12H,2,4-6,8-10H2,1H3,(H,16,21)(H2,15,17,18) |
| InChIKey | HBVUNEBWLKFSHS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|