C28H36N2 — CID 11188795
4-[4-[bis(prop-2-enyl)amino]-2,6-dimethylphenyl]-3,5-dimethyl-N,N-bis(prop-2-enyl)aniline (PubChem CID 11188795) has the molecular formula C28H36N2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[4-[bis(prop-2-enyl)amino]-2,6-dimethylphenyl]-3,5-dimethyl-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-[4-[bis(prop-2-enyl)amino]-2,6-dimethylphenyl]-3,5-dimethyl-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 11188795 |
| Molecular Formula | C28H36N2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 4-[4-[bis(prop-2-enyl)amino]-2,6-dimethylphenyl]-3,5-dimethyl-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1cc(C)c(-c2c(C)cc(N(CC=C)CC=C)cc2C)c(C)c1 |
| InChI | InChI=1S/C28H36N2/c1-9-13-29(14-10-2)25-17-21(5)27(22(6)18-25)28-23(7)19-26(20-24(28)8)30(15-11-3)16-12-4/h9-12,17-20H,1-4,13-16H2,5-8H3 |
| InChIKey | DSHGNBYTUFNNFQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|