C21H29FIN7O — CID 111888500
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111888500) has the molecular formula C21H29FIN7O and a molecular weight of 541.41 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888500 |
| Molecular Formula | C21H29FIN7O |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc2n(c1=O)CCCC2)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C21H28FN7O.HI/c1-23-20(25-10-8-15-14-26-18-13-16(22)6-7-17(15)18)24-9-4-12-29-21(30)28-11-3-2-5-19(28)27-29;/h6-7,13-14,26H,2-5,8-12H2,1H3,(H2,23,24,25);1H |
| InChIKey | WGRAXQQUFRHIHW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|