C16H19F3O7S — CID 11189105
methyl (1S,2R,5R,6R,7R)-5-(methoxymethoxymethyl)-3-(trifluoromethylsulfonyloxy)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate (PubChem CID 11189105) has the molecular formula C16H19F3O7S and a molecular weight of 412.38 g/mol. Its IUPAC name is methyl (1S,2R,5R,6R,7R)-5-(methoxymethoxymethyl)-3-(trifluoromethylsulfonyloxy)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate.
| Compound Name | methyl (1S,2R,5R,6R,7R)-5-(methoxymethoxymethyl)-3-(trifluoromethylsulfonyloxy)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
|---|---|
| PubChem CID | 11189105 |
| Molecular Formula | C16H19F3O7S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | methyl (1S,2R,5R,6R,7R)-5-(methoxymethoxymethyl)-3-(trifluoromethylsulfonyloxy)tricyclo[5.2.1.02,6]deca-3,8-diene-4-carboxylate |
| SMILES | COCOC[C@H]1C(C(=O)OC)=C(OS(=O)(=O)C(F)(F)F)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H19F3O7S/c1-23-7-25-6-10-11-8-3-4-9(5-8)12(11)14(13(10)15(20)24-2)26-27(21,22)16(17,18)19/h3-4,8-12H,5-7H2,1-2H3/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | UZPBKKQVGLHLIC-VSSNEEPJSA-N |
| XLogP | 1.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|