C17H22IN5S — CID 111893548
1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893548) has the molecular formula C17H22IN5S and a molecular weight of 455.37 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893548 |
| Molecular Formula | C17H22IN5S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc2ccccc2[nH]1)NCc1sccc1C.I |
| InChI | InChI=1S/C17H21N5S.HI/c1-12-8-10-23-15(12)11-20-17(18-2)19-9-7-16-21-13-5-3-4-6-14(13)22-16;/h3-6,8,10H,7,9,11H2,1-2H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | VFYOQQCYNXQZDX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|