C19H26IN5S — CID 111893676
1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893676) has the molecular formula C19H26IN5S and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893676 |
| Molecular Formula | C19H26IN5S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sccc1C)NCCCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C19H25N5S.HI/c1-3-20-19(22-13-17-14(2)10-12-25-17)21-11-6-9-18-23-15-7-4-5-8-16(15)24-18;/h4-5,7-8,10,12H,3,6,9,11,13H2,1-2H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | XPMZKHZIAQVLQL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|