C17H24N8 — CID 111708377
1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111708377) has the molecular formula C17H24N8 and a molecular weight of 340.44 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111708377 |
| Molecular Formula | C17H24N8 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H24N8/c1-3-18-17(20-11-16-21-12-22-25(16)2)19-10-6-9-15-23-13-7-4-5-8-14(13)24-15/h4-5,7-8,12H,3,6,9-11H2,1-2H3,(H,23,24)(H2,18,19,20) |
| InChIKey | UJXZDUKHQHTNSM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|