C20H29IN4O2 — CID 111894270
1-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 111894270) has the molecular formula C20H29IN4O2 and a molecular weight of 484.38 g/mol. Its IUPAC name is 1-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111894270 |
| Molecular Formula | C20H29IN4O2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\C)NCc1ccnc(Oc2ccc(C)c(C)c2)c1.I |
| InChI | InChI=1S/C20H28N4O2.HI/c1-5-25-11-10-23-20(21-4)24-14-17-8-9-22-19(13-17)26-18-7-6-15(2)16(3)12-18;/h6-9,12-13H,5,10-11,14H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | PABRTSGOHIEUMV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|