C22H23NO8 — CID 11189583
dimethyl (3R,4R,5R)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate (PubChem CID 11189583) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is dimethyl (3R,4R,5R)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate.
| Compound Name | dimethyl (3R,4R,5R)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11189583 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | dimethyl (3R,4R,5R)-3-(4-methoxyphenyl)-5-(4-methylphenyl)-4-nitrooxolane-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)O[C@H](c2ccc(C)cc2)[C@H]([N+](=O)[O-])[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23NO8/c1-13-5-7-15(8-6-13)19-18(23(26)27)17(14-9-11-16(28-2)12-10-14)22(31-19,20(24)29-3)21(25)30-4/h5-12,17-19H,1-4H3/t17-,18-,19-/m1/s1 |
| InChIKey | HIPCPLUKIFEWJI-GUDVDZBRSA-N |
| XLogP | 2.59 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|