C14H21Cl2N3O — CID 111897065
1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-ethoxyethyl)-2-methylguanidine (PubChem CID 111897065) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-ethoxyethyl)-2-methylguanidine.
| Compound Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-ethoxyethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111897065 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-ethoxyethyl)-2-methylguanidine |
| SMILES | CCOCCN/C(=N\C)NCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O/c1-3-20-10-9-19-14(17-2)18-8-7-11-12(15)5-4-6-13(11)16/h4-6H,3,7-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | MALXBUSNUJYFDW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|