C16H25Cl2N3O2 — CID 111407053
1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine (PubChem CID 111407053) has the molecular formula C16H25Cl2N3O2 and a molecular weight of 362.30 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111407053 |
| Molecular Formula | C16H25Cl2N3O2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCCOC)NCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H25Cl2N3O2/c1-19-16(20-8-4-10-23-12-11-22-2)21-9-7-13-14(17)5-3-6-15(13)18/h3,5-6H,4,7-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | LQAMCLRQWLYLHE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|