C26H28O4S — CID 11189795
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 4-phenylbuta-2,3-dienoate (PubChem CID 11189795) has the molecular formula C26H28O4S and a molecular weight of 436.57 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 4-phenylbuta-2,3-dienoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 4-phenylbuta-2,3-dienoate |
|---|---|
| PubChem CID | 11189795 |
| Molecular Formula | C26H28O4S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 4-phenylbuta-2,3-dienoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@@H](OC(=O)C=C=Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H28O4S/c1-25(2)21-16-17-26(25,19-31(28,29)22-13-7-4-8-14-22)23(18-21)30-24(27)15-9-12-20-10-5-3-6-11-20/h3-8,10-15,21,23H,16-19H2,1-2H3/t9?,21-,23-,26-/m0/s1 |
| InChIKey | YMDQQPNXYSOQIB-JVAGHDIPSA-N |
| XLogP | 5.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|