C19H13Cl2NO5S — CID 11189830
[3-(2,6-dichlorophenyl)-4-oxo-3a,6a-dihydrocyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate (PubChem CID 11189830) has the molecular formula C19H13Cl2NO5S and a molecular weight of 438.29 g/mol. Its IUPAC name is [3-(2,6-dichlorophenyl)-4-oxo-3a,6a-dihydrocyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-(2,6-dichlorophenyl)-4-oxo-3a,6a-dihydrocyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11189830 |
| Molecular Formula | C19H13Cl2NO5S |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | [3-(2,6-dichlorophenyl)-4-oxo-3a,6a-dihydrocyclopenta[d][1,2]oxazol-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CC(=O)C3C(c4c(Cl)cccc4Cl)=NOC23)cc1 |
| InChI | InChI=1S/C19H13Cl2NO5S/c1-10-5-7-11(8-6-10)28(24,25)27-15-9-14(23)17-18(22-26-19(15)17)16-12(20)3-2-4-13(16)21/h2-9,17,19H,1H3 |
| InChIKey | PMSSLVNUHDKILA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|