C19H31F2IN4 — CID 111901846
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-(3-methylpiperidin-1-yl)butyl]guanidine;hydroiodide (PubChem CID 111901846) has the molecular formula C19H31F2IN4 and a molecular weight of 480.39 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-(3-methylpiperidin-1-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-(3-methylpiperidin-1-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111901846 |
| Molecular Formula | C19H31F2IN4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[4-(3-methylpiperidin-1-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCN1CCCC(C)C1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C19H30F2N4.HI/c1-15-6-5-11-25(14-15)10-4-3-9-23-19(22-2)24-13-16-12-17(20)7-8-18(16)21;/h7-8,12,15H,3-6,9-11,13-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | BAWBZQNBEIOCFY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|