C23H32F2IN5O — CID 111902616
1-[(2,5-difluorophenyl)methyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methylguanidine;hydroiodide (PubChem CID 111902616) has the molecular formula C23H32F2IN5O and a molecular weight of 559.44 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111902616 |
| Molecular Formula | C23H32F2IN5O |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCN(c2ccc(OC)cc2)CC1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C23H31F2N5O.HI/c1-26-23(28-17-18-16-19(24)4-9-22(18)25)27-10-3-11-29-12-14-30(15-13-29)20-5-7-21(31-2)8-6-20;/h4-9,16H,3,10-15,17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | KICNPWDAABNIRT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|