C21H34IN7O — CID 111954906
1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111954906) has the molecular formula C21H34IN7O and a molecular weight of 527.46 g/mol. Its IUPAC name is 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111954906 |
| Molecular Formula | C21H34IN7O |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ccc(OC)cc2)CC1)NCc1ccnn1C.I |
| InChI | InChI=1S/C21H33N7O.HI/c1-22-21(24-17-19-9-11-25-26(19)2)23-10-4-12-27-13-15-28(16-14-27)18-5-7-20(29-3)8-6-18;/h5-9,11H,4,10,12-17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PQDFXVZPVIIIAV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|