C17H19F2N5O2 — CID 111902081
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine (PubChem CID 111902081) has the molecular formula C17H19F2N5O2 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine |
|---|---|
| PubChem CID | 111902081 |
| Molecular Formula | C17H19F2N5O2 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ccccc1[N+](=O)[O-])NCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2N5O2/c1-20-17(23-11-12-10-13(18)6-7-14(12)19)22-9-8-21-15-4-2-3-5-16(15)24(25)26/h2-7,10,21H,8-9,11H2,1H3,(H2,20,22,23) |
| InChIKey | GYPABGBYKWQKQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|