C17H22F2N4S — CID 111903413
1-[(2,5-difluorophenyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methylguanidine (PubChem CID 111903413) has the molecular formula C17H22F2N4S and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111903413 |
| Molecular Formula | C17H22F2N4S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1F)NCC(c1cccs1)N(C)C |
| InChI | InChI=1S/C17H22F2N4S/c1-20-17(21-10-12-9-13(18)6-7-14(12)19)22-11-15(23(2)3)16-5-4-8-24-16/h4-9,15H,10-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | GIKYUDZDYLISQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|