C16H25N5OS — CID 109430775
1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine (PubChem CID 109430775) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109430775 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1nc(C)c(C)o1)NCC(c1cccs1)N(C)C |
| InChI | InChI=1S/C16H25N5OS/c1-11-12(2)22-15(20-11)10-19-16(17-3)18-9-13(21(4)5)14-7-6-8-23-14/h6-8,13H,9-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | WGLSMIXBIIQMIA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|