C14H24N4S — CID 111963481
1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 111963481) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111963481 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-methyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | C/N=C(\NCC(c1cccs1)N(C)C)NC1CC1C |
| InChI | InChI=1S/C14H24N4S/c1-10-8-11(10)17-14(15-2)16-9-12(18(3)4)13-6-5-7-19-13/h5-7,10-12H,8-9H2,1-4H3,(H2,15,16,17) |
| InChIKey | QIGBDLLBYUIPEZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|