C20H35N5O2 — CID 111907429
2-[[[2-(furan-2-yl)ethylamino]-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111907429) has the molecular formula C20H35N5O2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111907429 |
| Molecular Formula | C20H35N5O2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC1CCCCN1CCCN/C(=N/CC(=O)N(C)C)NCCc1ccco1 |
| InChI | InChI=1S/C20H35N5O2/c1-17-8-4-5-13-25(17)14-7-11-21-20(23-16-19(26)24(2)3)22-12-10-18-9-6-15-27-18/h6,9,15,17H,4-5,7-8,10-14,16H2,1-3H3,(H2,21,22,23) |
| InChIKey | MSBMKFCRDPEDFU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|