C24H28N4O — CID 111909919
2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(1-phenylpyrrolidin-3-yl)guanidine (PubChem CID 111909919) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(1-phenylpyrrolidin-3-yl)guanidine.
| Compound Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(1-phenylpyrrolidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111909919 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-benzyl-1-[2-(furan-2-yl)ethyl]-3-(1-phenylpyrrolidin-3-yl)guanidine |
| SMILES | c1ccc(C/N=C(\NCCc2ccco2)NC2CCN(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H28N4O/c1-3-8-20(9-4-1)18-26-24(25-15-13-23-12-7-17-29-23)27-21-14-16-28(19-21)22-10-5-2-6-11-22/h1-12,17,21H,13-16,18-19H2,(H2,25,26,27) |
| InChIKey | APRXCMGDMZANRE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|