C20H35IN6 — CID 111910518
2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide (PubChem CID 111910518) has the molecular formula C20H35IN6 and a molecular weight of 486.45 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111910518 |
| Molecular Formula | C20H35IN6 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperazin-1-yl)propyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)N1CCN(C)CC1)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C20H34N6.HI/c1-17(25-13-11-24(3)12-14-25)15-22-20(21-2)23-18-9-10-26(16-18)19-7-5-4-6-8-19;/h4-8,17-18H,9-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZKRLXZKENHRMMZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|