C15H28N4O2 — CID 111911150
tert-butyl 3-[[amino-(4-methylpiperidin-1-yl)methylidene]amino]azetidine-1-carboxylate (PubChem CID 111911150) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl 3-[[amino-(4-methylpiperidin-1-yl)methylidene]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[amino-(4-methylpiperidin-1-yl)methylidene]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 111911150 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl 3-[[amino-(4-methylpiperidin-1-yl)methylidene]amino]azetidine-1-carboxylate |
| SMILES | CC1CCN(/C(N)=N/C2CN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C15H28N4O2/c1-11-5-7-18(8-6-11)13(16)17-12-9-19(10-12)14(20)21-15(2,3)4/h11-12H,5-10H2,1-4H3,(H2,16,17) |
| InChIKey | CAMUBNOTDHCOJB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|