C19H27ClN6 — CID 111911388
2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111911388) has the molecular formula C19H27ClN6 and a molecular weight of 374.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111911388 |
| Molecular Formula | C19H27ClN6 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/CC(c1ccc(Cl)cc1)n1cccn1 |
| InChI | InChI=1S/C19H27ClN6/c1-2-25-11-3-5-17(25)13-22-19(21)23-14-18(26-12-4-10-24-26)15-6-8-16(20)9-7-15/h4,6-10,12,17-18H,2-3,5,11,13-14H2,1H3,(H3,21,22,23) |
| InChIKey | RINDBXDRWICAMU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|