C17H25FN6O — CID 111913626
2-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl-pentylamino]ethanol (PubChem CID 111913626) has the molecular formula C17H25FN6O and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl-pentylamino]ethanol.
| Compound Name | 2-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl-pentylamino]ethanol |
|---|---|
| PubChem CID | 111913626 |
| Molecular Formula | C17H25FN6O |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl-pentylamino]ethanol |
| SMILES | CCCCCN(CCO)Cc1nc(N)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H25FN6O/c1-2-3-4-9-24(10-11-25)12-15-21-16(19)23-17(22-15)20-14-7-5-13(18)6-8-14/h5-8,25H,2-4,9-12H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | XXVDPHLHSFSRKP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|