C24H24FN7O3 — CID 46641704
[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 46641704) has the molecular formula C24H24FN7O3 and a molecular weight of 477.50 g/mol. Its IUPAC name is [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 46641704 |
| Molecular Formula | C24H24FN7O3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCc2nc(N)nc(Nc3ccc(F)cc3)n2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H24FN7O3/c1-2-3-6-13-32-21(33)18-8-5-4-7-17(18)20(31-32)22(34)35-14-19-28-23(26)30-24(29-19)27-16-11-9-15(25)10-12-16/h4-5,7-12H,2-3,6,13-14H2,1H3,(H3,26,27,28,29,30) |
| InChIKey | NGIKCGUFVDBKNR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|