C29H38ClNO5 — CID 11191549
methyl 5-[[(4-dec-1-ynylphenyl)methylamino]methyl]-2-(2-methoxy-2-oxoethoxy)benzoate;hydrochloride (PubChem CID 11191549) has the molecular formula C29H38ClNO5 and a molecular weight of 516.08 g/mol. Its IUPAC name is methyl 5-[[(4-dec-1-ynylphenyl)methylamino]methyl]-2-(2-methoxy-2-oxoethoxy)benzoate;hydrochloride.
| Compound Name | methyl 5-[[(4-dec-1-ynylphenyl)methylamino]methyl]-2-(2-methoxy-2-oxoethoxy)benzoate;hydrochloride |
|---|---|
| PubChem CID | 11191549 |
| Molecular Formula | C29H38ClNO5 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | methyl 5-[[(4-dec-1-ynylphenyl)methylamino]methyl]-2-(2-methoxy-2-oxoethoxy)benzoate;hydrochloride |
| SMILES | CCCCCCCCC#Cc1ccc(CNCc2ccc(OCC(=O)OC)c(C(=O)OC)c2)cc1.Cl |
| InChI | InChI=1S/C29H37NO5.ClH/c1-4-5-6-7-8-9-10-11-12-23-13-15-24(16-14-23)20-30-21-25-17-18-27(35-22-28(31)33-2)26(19-25)29(32)34-3;/h13-19,30H,4-10,20-22H2,1-3H3;1H |
| InChIKey | XTMIXFAHRJEZDO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|