C16H19ClN2OS — CID 111916295
1-(3-chlorophenyl)-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethanol (PubChem CID 111916295) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethanol |
|---|---|
| PubChem CID | 111916295 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[[1-(1,3-thiazol-2-yl)cyclopentyl]amino]ethanol |
| SMILES | OC(CNC1(c2nccs2)CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H19ClN2OS/c17-13-5-3-4-12(10-13)14(20)11-19-16(6-1-2-7-16)15-18-8-9-21-15/h3-5,8-10,14,19-20H,1-2,6-7,11H2 |
| InChIKey | ZUZLGQDNDZEKFO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |