C11H19ClN4O2S — CID 111916389
1-[(5-chlorothiadiazol-4-yl)methyl-methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 111916389) has the molecular formula C11H19ClN4O2S and a molecular weight of 306.82 g/mol. Its IUPAC name is 1-[(5-chlorothiadiazol-4-yl)methyl-methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[(5-chlorothiadiazol-4-yl)methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 111916389 |
| Molecular Formula | C11H19ClN4O2S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[(5-chlorothiadiazol-4-yl)methyl-methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CN(Cc1nnsc1Cl)CC(O)CN1CCOCC1 |
| InChI | InChI=1S/C11H19ClN4O2S/c1-15(8-10-11(12)19-14-13-10)6-9(17)7-16-2-4-18-5-3-16/h9,17H,2-8H2,1H3 |
| InChIKey | YLSTWCAYKYVLML-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |