About [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol
[1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol (PubChem CID 111916814) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol |
| PubChem CID | 111916814 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol |
| SMILES | Cc1noc(C)c1COc1ccc(CNC2(CO)CCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-14-18(15(2)24-21-14)12-23-17-7-5-16(6-8-17)11-20-19(13-22)9-3-4-10-19/h5-8,20,22H,3-4,9-13H2,1-2H3 |
| InChIKey | LESUPVABQQBEFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol?
The IUPAC name of [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol (CID 111916814) is [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol.
What is the SMILES notation for [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol?
The canonical SMILES for [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol is Cc1noc(C)c1COc1ccc(CNC2(CO)CCCC2)cc1.
What is the InChIKey of [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol?
The InChIKey is LESUPVABQQBEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-14-18(15(2)24-21-14)12-23-17-7-5-16(6-8-17)11-20-19(13-22)9-3-4-10-19/h5-8,20,22H,3-4,9-13H2,1-2H3.
What are the key properties of [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol?
[1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol has a molecular weight of 330.43 g/mol, XLogP of 3.27, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]cyclopentyl]methanol is sourced from PubChem (CID 111916814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).