C21H36IN5S — CID 111919632
1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111919632) has the molecular formula C21H36IN5S and a molecular weight of 517.53 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111919632 |
| Molecular Formula | C21H36IN5S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc2c(s1)CCCC2)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C21H35N5S.HI/c1-22-21(24-16-12-14-26(15-16)17-7-2-3-8-17)23-13-6-11-20-25-18-9-4-5-10-19(18)27-20;/h16-17H,2-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | REYKCBPORRRNBU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|