C18H30N4S — CID 111211891
N',4-dimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-1-carboximidamide (PubChem CID 111211891) has the molecular formula C18H30N4S and a molecular weight of 334.53 g/mol. Its IUPAC name is N',4-dimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | N',4-dimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111211891 |
| Molecular Formula | C18H30N4S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | N',4-dimethyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nc2c(s1)CCCC2)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H30N4S/c1-14-9-12-22(13-10-14)18(19-2)20-11-5-8-17-21-15-6-3-4-7-16(15)23-17/h14H,3-13H2,1-2H3,(H,19,20) |
| InChIKey | GQTOFEIDDUZNLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|