C18H30N4OS — CID 111737033
3-(methoxymethyl)-N'-methyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111737033) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111737033 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCc1nc2c(s1)CCCC2)N1CCC(COC)C1 |
| InChI | InChI=1S/C18H30N4OS/c1-19-18(22-11-9-14(12-22)13-23-2)20-10-5-8-17-21-15-6-3-4-7-16(15)24-17/h14H,3-13H2,1-2H3,(H,19,20) |
| InChIKey | WFIKHNKPPLEOBR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|