C21H38N6O — CID 111920175
1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine (PubChem CID 111920175) has the molecular formula C21H38N6O and a molecular weight of 390.58 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111920175 |
| Molecular Formula | C21H38N6O |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C21H38N6O/c1-5-22-21(24-18-10-11-26(15-18)19-8-6-7-9-19)23-14-20-16(2)25-27(17(20)3)12-13-28-4/h18-19H,5-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | YIHNFKJANAEDIJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|