C32H34ClFN4O2 — CID 11192244
3-[4-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)methoxy-[1-(5-hydroxypentyl)piperidin-4-yl]methyl]phenyl]benzonitrile (PubChem CID 11192244) has the molecular formula C32H34ClFN4O2 and a molecular weight of 561.10 g/mol. Its IUPAC name is 3-[4-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)methoxy-[1-(5-hydroxypentyl)piperidin-4-yl]methyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)methoxy-[1-(5-hydroxypentyl)piperidin-4-yl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 11192244 |
| Molecular Formula | C32H34ClFN4O2 |
| Molecular Weight | 561.10 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 3-[4-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)methoxy-[1-(5-hydroxypentyl)piperidin-4-yl]methyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C(OCc3nc4cc(Cl)c(F)cc4[nH]3)C3CCN(CCCCCO)CC3)cc2)c1 |
| InChI | InChI=1S/C32H34ClFN4O2/c33-27-18-29-30(19-28(27)34)37-31(36-29)21-40-32(25-11-14-38(15-12-25)13-2-1-3-16-39)24-9-7-23(8-10-24)26-6-4-5-22(17-26)20-35/h4-10,17-19,25,32,39H,1-3,11-16,21H2,(H,36,37) |
| InChIKey | AGOIEYRFJZYARS-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.10 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|