About [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate
[2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate (PubChem CID 20792824) has the molecular formula C29H29Cl2N3O2
and a molecular weight of 522.48 g/mol. Its IUPAC name is [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate.
Molecular Properties
| Compound Name | [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate |
| PubChem CID | 20792824 |
| Molecular Formula | C29H29Cl2N3O2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate |
| SMILES | CCN1CCC(C(COC(=O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3cccc(C#N)c3)cc2)CC1 |
| InChI | InChI=1S/C29H29Cl2N3O2/c1-2-34-12-10-23(11-13-34)28(19-36-29(35)33-27-16-25(30)15-26(31)17-27)22-8-6-21(7-9-22)24-5-3-4-20(14-24)18-32/h3-9,14-17,23,28H,2,10-13,19H2,1H3,(H,33,35) |
| InChIKey | UNYPZVPKASYANJ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate?
The IUPAC name of [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate (CID 20792824) is [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate.
What is the SMILES notation for [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate?
The canonical SMILES for [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate is CCN1CCC(C(COC(=O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3cccc(C#N)c3)cc2)CC1.
What is the InChIKey of [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate?
The InChIKey is UNYPZVPKASYANJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29Cl2N3O2/c1-2-34-12-10-23(11-13-34)28(19-36-29(35)33-27-16-25(30)15-26(31)17-27)22-8-6-21(7-9-22)24-5-3-4-20(14-24)18-32/h3-9,14-17,23,28H,2,10-13,19H2,1H3,(H,33,35).
What are the key properties of [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate?
[2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate has a molecular weight of 522.48 g/mol, XLogP of 7.60, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3-cyanophenyl)phenyl]-2-(1-ethylpiperidin-4-yl)ethyl] N-(3,5-dichlorophenyl)carbamate is sourced from PubChem (CID 20792824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).