C28H30Cl2N4O — CID 59834762
3-[4-[2-[[(R)-(3,5-dichloroanilino)-hydroxymethyl]amino]-1-(1-methylpiperidin-4-yl)ethyl]phenyl]benzonitrile (PubChem CID 59834762) has the molecular formula C28H30Cl2N4O and a molecular weight of 509.48 g/mol. Its IUPAC name is 3-[4-[2-[[(R)-(3,5-dichloroanilino)-hydroxymethyl]amino]-1-(1-methylpiperidin-4-yl)ethyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[2-[[(R)-(3,5-dichloroanilino)-hydroxymethyl]amino]-1-(1-methylpiperidin-4-yl)ethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 59834762 |
| Molecular Formula | C28H30Cl2N4O |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 3-[4-[2-[[(R)-(3,5-dichloroanilino)-hydroxymethyl]amino]-1-(1-methylpiperidin-4-yl)ethyl]phenyl]benzonitrile |
| SMILES | CN1CCC(C(CN[C@@H](O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3cccc(C#N)c3)cc2)CC1 |
| InChI | InChI=1S/C28H30Cl2N4O/c1-34-11-9-22(10-12-34)27(18-32-28(35)33-26-15-24(29)14-25(30)16-26)21-7-5-20(6-8-21)23-4-2-3-19(13-23)17-31/h2-8,13-16,22,27-28,32-33,35H,9-12,18H2,1H3/t27?,28-/m1/s1 |
| InChIKey | RBUMLJVMKMTJSD-PLYLYKGUSA-N |
| XLogP | 5.94 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|