C34H40N4 — CID 143014573
4-(1-benzylpiperidin-4-yl)-N-[(E)-but-2-en-2-yl]-4-[4-(3-cyanophenyl)phenyl]-N'-methylbutanimidamide (PubChem CID 143014573) has the molecular formula C34H40N4 and a molecular weight of 504.72 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-N-[(E)-but-2-en-2-yl]-4-[4-(3-cyanophenyl)phenyl]-N'-methylbutanimidamide.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-N-[(E)-but-2-en-2-yl]-4-[4-(3-cyanophenyl)phenyl]-N'-methylbutanimidamide |
|---|---|
| PubChem CID | 143014573 |
| Molecular Formula | C34H40N4 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-N-[(E)-but-2-en-2-yl]-4-[4-(3-cyanophenyl)phenyl]-N'-methylbutanimidamide |
| SMILES | C/C=C(\C)N/C(CCC(c1ccc(-c2cccc(C#N)c2)cc1)C1CCN(Cc2ccccc2)CC1)=N\C |
| InChI | InChI=1S/C34H40N4/c1-4-26(2)37-34(36-3)18-17-33(31-19-21-38(22-20-31)25-27-9-6-5-7-10-27)30-15-13-29(14-16-30)32-12-8-11-28(23-32)24-35/h4-16,23,31,33H,17-22,25H2,1-3H3,(H,36,37)/b26-4+ |
| InChIKey | WVBJUJYFDVDUQI-APJQVKJYSA-N |
| XLogP | 7.54 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|