C22H35IN6O2 — CID 111924654
1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111924654) has the molecular formula C22H35IN6O2 and a molecular weight of 542.47 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111924654 |
| Molecular Formula | C22H35IN6O2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cnn(C)c1)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C22H34N6O2.HI/c1-5-23-22(24-9-6-7-17-14-25-27(2)15-17)26-18-8-10-28(16-18)19-11-20(29-3)13-21(12-19)30-4;/h11-15,18H,5-10,16H2,1-4H3,(H2,23,24,26);1H |
| InChIKey | UZIVLNSZTSYHSX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|