C23H30N4O5 — CID 111924781
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine (PubChem CID 111924781) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111924781 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\NCCOc1ccc2c(c1)OCO2)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C23H30N4O5/c1-24-23(25-7-9-30-18-4-5-21-22(13-18)32-15-31-21)26-16-6-8-27(14-16)17-10-19(28-2)12-20(11-17)29-3/h4-5,10-13,16H,6-9,14-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | GRAQPSSZJWWBFS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|