C17H26IN3O3S — CID 111528120
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111528120) has the molecular formula C17H26IN3O3S and a molecular weight of 479.38 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111528120 |
| Molecular Formula | C17H26IN3O3S |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc2c(c1)OCO2)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H25N3O3S.HI/c1-18-17(20-12-3-5-14(9-12)24-2)19-7-8-21-13-4-6-15-16(10-13)23-11-22-15;/h4,6,10,12,14H,3,5,7-9,11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | PGTLJRXOTNPPGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|