C18H32N4O2 — CID 111926302
1-(1,3-ditert-butylpyrazol-5-yl)-3-[1-(hydroxymethyl)cyclopentyl]urea (PubChem CID 111926302) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(1,3-ditert-butylpyrazol-5-yl)-3-[1-(hydroxymethyl)cyclopentyl]urea.
| Compound Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-[1-(hydroxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 111926302 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-[1-(hydroxymethyl)cyclopentyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)NC2(CO)CCCC2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H32N4O2/c1-16(2,3)13-11-14(22(21-13)17(4,5)6)19-15(24)20-18(12-23)9-7-8-10-18/h11,23H,7-10,12H2,1-6H3,(H2,19,20,24) |
| InChIKey | AJPPARHGZKFEBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |