C15H24N4O3 — CID 95174335
trans-(1S,2S)-N-(1,3-ditert-butylpyrazol-5-yl)-2-nitrocyclopropane-1-carboxamide (PubChem CID 95174335) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is trans-(1S,2S)-N-(1,3-ditert-butylpyrazol-5-yl)-2-nitrocyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-(1,3-ditert-butylpyrazol-5-yl)-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95174335 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | trans-(1S,2S)-N-(1,3-ditert-butylpyrazol-5-yl)-2-nitrocyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)[C@H]2C[C@@H]2[N+](=O)[O-])n(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H24N4O3/c1-14(2,3)11-8-12(18(17-11)15(4,5)6)16-13(20)9-7-10(9)19(21)22/h8-10H,7H2,1-6H3,(H,16,20)/t9-,10-/m0/s1 |
| InChIKey | LWGXPFVKYUFDGF-UWVGGRQHSA-N |
| XLogP | 2.54 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|