C19H28N4O — CID 770901
1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-methylphenyl)urea (PubChem CID 770901) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 770901 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(C)(C)C)nn2C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N4O/c1-13-8-10-14(11-9-13)20-17(24)21-16-12-15(18(2,3)4)22-23(16)19(5,6)7/h8-12H,1-7H3,(H2,20,21,24) |
| InChIKey | XCKKKMVHFXLGGR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |