C19H29ClN4O — CID 120625352
5-amino-N-(1,3-ditert-butylpyrazol-5-yl)-2-methylbenzamide;hydrochloride (PubChem CID 120625352) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 5-amino-N-(1,3-ditert-butylpyrazol-5-yl)-2-methylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-(1,3-ditert-butylpyrazol-5-yl)-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120625352 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-amino-N-(1,3-ditert-butylpyrazol-5-yl)-2-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)Nc1cc(C(C)(C)C)nn1C(C)(C)C.Cl |
| InChI | InChI=1S/C19H28N4O.ClH/c1-12-8-9-13(20)10-14(12)17(24)21-16-11-15(18(2,3)4)22-23(16)19(5,6)7;/h8-11H,20H2,1-7H3,(H,21,24);1H |
| InChIKey | QZPFKRZPKIBOPK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|