C16H31ClN4O2 — CID 119747423
N-(1,3-ditert-butylpyrazol-5-yl)-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119747423) has the molecular formula C16H31ClN4O2 and a molecular weight of 346.90 g/mol. Its IUPAC name is N-(1,3-ditert-butylpyrazol-5-yl)-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-(1,3-ditert-butylpyrazol-5-yl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119747423 |
| Molecular Formula | C16H31ClN4O2 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-(1,3-ditert-butylpyrazol-5-yl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cc(C(C)(C)C)nn1C(C)(C)C.Cl |
| InChI | InChI=1S/C16H30N4O2.ClH/c1-15(2,3)12-10-13(20(19-12)16(4,5)6)18-14(21)11-17-8-9-22-7;/h10,17H,8-9,11H2,1-7H3,(H,18,21);1H |
| InChIKey | SMDUGZJKKQWPKR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|